View source for JTE 7-31

{{chembox
| Verifiedfields   = changed
| Watchedfields    = changed
| verifiedrevid    = 453317265
| ImageFile        = JTE_7-31 Structure.svg 
| ImageSize        = 220px
| PIN              = 2-[2-(4-Hydroxyphenyl)ethyl]-5-methoxy-4-(pentylamino)-2,3-dihydro-1''H''-isoindol-1-one
| OtherNames       = 
| Section1         = {{Chembox Identifiers
| Abbreviations    = 
| CASNo_Ref        = {{cascite|correct|CAS}}
| CASNo            = 194358-72-0
| UNII_Ref         = {{fdacite|correct|FDA}}
| UNII             = 7MV5OX2NX0
| EINECS           = 
| PubChem          = 19363402
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID     = 13767708
| SMILES           = Oc1ccc(cc1)CCN3Cc2c(ccc(OC)c2NCCCCC)C3=O
| InChI            = 1/C22H28N2O3/c1-3-4-5-13-23-21-19-15-24(14-12-16-6-8-17(25)9-7-16)22(26)18(19)10-11-20(21)27-2/h6-11,23,25H,3-5,12-15H2,1-2H3
| InChIKey         = FMUMUYFMLZGXJR-UHFFFAOYAA
| StdInChI_Ref     = {{stdinchicite|correct|chemspider}}
| StdInChI         = 1S/C22H28N2O3/c1-3-4-5-13-23-21-19-15-24(14-12-16-6-8-17(25)9-7-16)22(26)18(19)10-11-20(21)27-2/h6-11,23,25H,3-5,12-15H2,1-2H3
| StdInChIKey_Ref  = {{stdinchicite|correct|chemspider}}
| StdInChIKey      = FMUMUYFMLZGXJR-UHFFFAOYSA-N
| RTECS            =
| MeSHName         = 
| ChEBI_Ref        = {{ebicite|correct|EBI}}
| ChEBI            = 
| KEGG_Ref         = {{keggcite|correct|kegg}}
| KEGG             = 
}}
| Section2         = {{Chembox Properties
| Formula          = C<sub>22</sub>H<sub>28</sub>N<sub>2</sub>O<sub>3</sub>
| MolarMass        = 368.469 g/mol
| Appearance       =
| Density          = 
| MeltingPt        = 
| MeltingPt_notes  =
| BoilingPt        = 
| BoilingPt_notes  = 
| Solubility       = 
| SolubleOther     = 
| Solvent          = 
| pKa              = 
| pKb              = 
}}
|Section7          = {{Chembox Hazards
| ExternalSDS      = 
| MainHazards      = 
| NFPA-H           = 
| NFPA-F           = 
| NFPA-R           = 
| NFPA-S           = 
| FlashPt          = 
| AutoignitionPt   = 
| ExploLimits      = 
| PEL = 
}}
}}

'''JTE 7-31''' is a selective [[cannabinoid receptor]] agonist invented by [[Japan Tobacco]].<ref name="WO 1997/029079">{{Ref patent2 |country= WO |number= 1997/029079 |status= granted |title= Novel compounds and pharmaceutical use thereof |pubdate= 1997-31-07 |gdate= 1997-14-08 |pridate= 1997-06-02 |inventor =Inaba T, Kaya T, Iwamura H }}</ref><ref name="US 6017919">{{Ref patent2 |country = US |number= 6017919 |status= granted |title= Compounds and pharmaceutical use thereof |pubdate= 1998-08-06 |gdate= 2000-01-25 |pridate= 1998-08-06 |inventor= Inaba T, Kaya T, Iwamura H }}</ref> It is a reasonably highly selective [[Cannabinoid receptor 2|CB<sub>2</sub>]] agonist, but still retains appreciable affinity at [[Cannabinoid receptor 1|CB<sub>1</sub>]], with a [[dissociation constant|K<sub>i</sub>]] of 0.088nM at CB<sub>2</sub> vs 11nM at CB<sub>1</sub>.<ref name="pmid25644673">{{cite journal | vauthors = Han S, Zhang FF, Qian HY, Chen LL, Pu JB, Xie X, Chen JZ | title = Design, syntheses, structure-activity relationships and docking studies of coumarin derivatives as novel selective ligands for the CB2 receptor | journal = European Journal of Medicinal Chemistry | volume = 93 | issue = | pages = 16–32 | date = March 2015 | pmid = 25644673 | doi = 10.1016/j.ejmech.2015.01.054 }}</ref>

==Legality==
JTE 7-31 is illegal in [[Alabama]].<ref>{{cite web | url = https://legiscan.com/AL/text/SB333/id/988417/Alabama-2014-SB333-Enrolled.pdf | title = Alabama Senate Bill SB 333: Controlled Substances }}</ref>

==See also==
* [[A-834,735]]
* [[JTE-907]]
* [[MDA-19]]
* [[N-(S)-Fenchyl-1-(2-morpholinoethyl)-7-methoxyindole-3-carboxamide]]
* [[S-444,823]]
* [[XLR-12]]

==References==
{{reflist}}

==External links==

{{Cannabinoids}}

[[Category:Cannabinoids]]
[[Category:Japan Tobacco]]


{{cannabinoid-stub}}